C8H14IN3 — CID 118972141
2-iodo-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]ethanamine (PubChem CID 118972141) has the molecular formula C8H14IN3 and a molecular weight of 279.13 g/mol. Its IUPAC name is 2-iodo-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]ethanamine.
| Compound Name | 2-iodo-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 118972141 |
| Molecular Formula | C8H14IN3 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-iodo-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]ethanamine |
| SMILES | Cc1[nH]ncc1CN(C)CCI |
| InChI | InChI=1S/C8H14IN3/c1-7-8(5-10-11-7)6-12(2)4-3-9/h5H,3-4,6H2,1-2H3,(H,10,11) |
| InChIKey | HZOHMNYNBJLQQQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|