C29H28F2N6O — CID 118972185
2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-N-pyridin-4-yl-3,5,6,7,8,8a-hexahydroquinazolin-4-amine (PubChem CID 118972185) has the molecular formula C29H28F2N6O and a molecular weight of 514.58 g/mol. Its IUPAC name is 2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-N-pyridin-4-yl-3,5,6,7,8,8a-hexahydroquinazolin-4-amine.
| Compound Name | 2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-N-pyridin-4-yl-3,5,6,7,8,8a-hexahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 118972185 |
| Molecular Formula | C29H28F2N6O |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-N-pyridin-4-yl-3,5,6,7,8,8a-hexahydroquinazolin-4-amine |
| SMILES | CCOc1cc(F)c(Cn2nc(C3=NC4CCCCC4=C(Nc4ccncc4)N3)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C29H28F2N6O/c1-2-38-19-15-23(30)22(24(31)16-19)17-37-26-10-6-4-8-21(26)27(36-37)29-34-25-9-5-3-7-20(25)28(35-29)33-18-11-13-32-14-12-18/h4,6,8,10-16,25H,2-3,5,7,9,17H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | BJIZUQJGCPYLBG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |