C28H17F3N2O2 — CID 118972407
4-(3,6-dimethylcarbazol-9-yl)-5,6,7-trifluoro-2-phenylisoindole-1,3-dione (PubChem CID 118972407) has the molecular formula C28H17F3N2O2 and a molecular weight of 470.45 g/mol. Its IUPAC name is 4-(3,6-dimethylcarbazol-9-yl)-5,6,7-trifluoro-2-phenylisoindole-1,3-dione.
| Compound Name | 4-(3,6-dimethylcarbazol-9-yl)-5,6,7-trifluoro-2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 118972407 |
| Molecular Formula | C28H17F3N2O2 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 4-(3,6-dimethylcarbazol-9-yl)-5,6,7-trifluoro-2-phenylisoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1c(F)c(F)c(F)c2c1C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C28H17F3N2O2/c1-14-8-10-19-17(12-14)18-13-15(2)9-11-20(18)33(19)26-22-21(23(29)24(30)25(26)31)27(34)32(28(22)35)16-6-4-3-5-7-16/h3-13H,1-2H3 |
| InChIKey | GVIVTBNBPCPVIE-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|