C24H18N6O — CID 11897271
(4R,4aR,7aR)-5-amino-3-methyl-7-oxo-2,4-diphenyl-4,8-dihydropyrrolo[3,4-f]indazole-4a,7a-dicarbonitrile (PubChem CID 11897271) has the molecular formula C24H18N6O and a molecular weight of 406.45 g/mol. Its IUPAC name is (4R,4aR,7aR)-5-amino-3-methyl-7-oxo-2,4-diphenyl-4,8-dihydropyrrolo[3,4-f]indazole-4a,7a-dicarbonitrile.
| Compound Name | (4R,4aR,7aR)-5-amino-3-methyl-7-oxo-2,4-diphenyl-4,8-dihydropyrrolo[3,4-f]indazole-4a,7a-dicarbonitrile |
|---|---|
| PubChem CID | 11897271 |
| Molecular Formula | C24H18N6O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (4R,4aR,7aR)-5-amino-3-methyl-7-oxo-2,4-diphenyl-4,8-dihydropyrrolo[3,4-f]indazole-4a,7a-dicarbonitrile |
| SMILES | Cc1c2c(nn1-c1ccccc1)C[C@@]1(C#N)C(=O)N=C(N)[C@]1(C#N)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C24H18N6O/c1-15-19-18(29-30(15)17-10-6-3-7-11-17)12-23(13-25)22(31)28-21(27)24(23,14-26)20(19)16-8-4-2-5-9-16/h2-11,20H,12H2,1H3,(H2,27,28,31)/t20-,23-,24+/m1/s1 |
| InChIKey | BBDJVXNRJCLOMS-HUVFLSCGSA-N |
| XLogP | 2.79 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |