About (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide
(Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide (PubChem CID 118972787) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide.
Molecular Properties
| Compound Name | (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide |
| PubChem CID | 118972787 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide |
| SMILES | C/N=C(/C=C(/C)N)C(=O)N(C)C |
| InChI | InChI=1S/C8H15N3O/c1-6(9)5-7(10-2)8(12)11(3)4/h5H,9H2,1-4H3/b6-5-,10-7- |
| InChIKey | OWCOZPXYFBJXMZ-ICZHLNMZSA-N |
| XLogP | 0.01 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide?
The IUPAC name of (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide (CID 118972787) is (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide.
What is the SMILES notation for (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide?
The canonical SMILES for (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide is C/N=C(/C=C(/C)N)C(=O)N(C)C.
What is the InChIKey of (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide?
The InChIKey is OWCOZPXYFBJXMZ-ICZHLNMZSA-N. The full InChI is InChI=1S/C8H15N3O/c1-6(9)5-7(10-2)8(12)11(3)4/h5H,9H2,1-4H3/b6-5-,10-7-.
What are the key properties of (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide?
(Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide has a molecular weight of 169.23 g/mol, XLogP of 0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-amino-N,N-dimethyl-2-methyliminopent-3-enamide is sourced from PubChem (CID 118972787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).