About N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide
N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide (PubChem CID 118973028) has the molecular formula C12H25N5
and a molecular weight of 239.37 g/mol. Its IUPAC name is N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide |
| PubChem CID | 118973028 |
| Molecular Formula | C12H25N5 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide |
| SMILES | C/N=C/N/C(=C\CNC)N1CCN(C)[C@@H](C)C1 |
| InChI | InChI=1S/C12H25N5/c1-11-9-17(8-7-16(11)4)12(5-6-13-2)15-10-14-3/h5,10-11,13H,6-9H2,1-4H3,(H,14,15)/b12-5+/t11-/m0/s1 |
| InChIKey | IRMTYUGSTPHVSR-FIJZOYEMSA-N |
| XLogP | -0.07 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide?
The IUPAC name of N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide (CID 118973028) is N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide.
What is the SMILES notation for N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide?
The canonical SMILES for N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide is C/N=C/N/C(=C\CNC)N1CCN(C)[C@@H](C)C1.
What is the InChIKey of N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide?
The InChIKey is IRMTYUGSTPHVSR-FIJZOYEMSA-N. The full InChI is InChI=1S/C12H25N5/c1-11-9-17(8-7-16(11)4)12(5-6-13-2)15-10-14-3/h5,10-11,13H,6-9H2,1-4H3,(H,14,15)/b12-5+/t11-/m0/s1.
What are the key properties of N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide?
N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide has a molecular weight of 239.37 g/mol, XLogP of -0.07, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-[(3S)-3,4-dimethylpiperazin-1-yl]-3-(methylamino)prop-1-enyl]-N'-methylmethanimidamide is sourced from PubChem (CID 118973028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).