About (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide
(Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide (PubChem CID 118973186) has the molecular formula C10H21N3
and a molecular weight of 183.30 g/mol. Its IUPAC name is (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide |
| PubChem CID | 118973186 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide |
| SMILES | CCCN(CC)C(=N\C)/C(C)=C\N |
| InChI | InChI=1S/C10H21N3/c1-5-7-13(6-2)10(12-4)9(3)8-11/h8H,5-7,11H2,1-4H3/b9-8-,12-10- |
| InChIKey | HISMQNAMMTZUKH-DMGFJBLZSA-N |
| XLogP | 1.61 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide?
The IUPAC name of (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide (CID 118973186) is (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide.
What is the SMILES notation for (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide?
The canonical SMILES for (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide is CCCN(CC)C(=N\C)/C(C)=C\N.
What is the InChIKey of (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide?
The InChIKey is HISMQNAMMTZUKH-DMGFJBLZSA-N. The full InChI is InChI=1S/C10H21N3/c1-5-7-13(6-2)10(12-4)9(3)8-11/h8H,5-7,11H2,1-4H3/b9-8-,12-10-.
What are the key properties of (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide?
(Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide has a molecular weight of 183.30 g/mol, XLogP of 1.61, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-N-ethyl-N',2-dimethyl-N-propylprop-2-enimidamide is sourced from PubChem (CID 118973186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).