C12H19N5 — CID 118973188
(2E,4Z)-N-(aminomethylidene)-N',2-dimethyl-4-(methylideneamino)-5-(propylideneamino)penta-2,4-dienimidamide (PubChem CID 118973188) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is (2E,4Z)-N-(aminomethylidene)-N',2-dimethyl-4-(methylideneamino)-5-(propylideneamino)penta-2,4-dienimidamide.
| Compound Name | (2E,4Z)-N-(aminomethylidene)-N',2-dimethyl-4-(methylideneamino)-5-(propylideneamino)penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 118973188 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (2E,4Z)-N-(aminomethylidene)-N',2-dimethyl-4-(methylideneamino)-5-(propylideneamino)penta-2,4-dienimidamide |
| SMILES | C=NC(=C\N=C\CC)/C=C(C)/C(=N/C)/N=C/N |
| InChI | InChI=1S/C12H19N5/c1-5-6-16-8-11(14-3)7-10(2)12(15-4)17-9-13/h6-9H,3,5H2,1-2,4H3,(H2,13,15,17)/b10-7+,11-8-,16-6+ |
| InChIKey | WLVVKNUMYIIXMN-QYGHMLGPSA-N |
| XLogP | 1.97 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|