About N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide
N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide (PubChem CID 118973362) has the molecular formula C12H21N5O
and a molecular weight of 251.33 g/mol. Its IUPAC name is N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide |
| PubChem CID | 118973362 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(C2=CC(C)N=CN2)CC1 |
| InChI | InChI=1S/C12H21N5O/c1-3-13-12(18)17-6-4-16(5-7-17)11-8-10(2)14-9-15-11/h8-10H,3-7H2,1-2H3,(H,13,18)(H,14,15) |
| InChIKey | ZZMUDDDDTXKGAY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide?
The IUPAC name of N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide (CID 118973362) is N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide.
What is the SMILES notation for N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide?
The canonical SMILES for N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide is CCNC(=O)N1CCN(C2=CC(C)N=CN2)CC1.
What is the InChIKey of N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide?
The InChIKey is ZZMUDDDDTXKGAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O/c1-3-13-12(18)17-6-4-16(5-7-17)11-8-10(2)14-9-15-11/h8-10H,3-7H2,1-2H3,(H,13,18)(H,14,15).
What are the key properties of N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide?
N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide has a molecular weight of 251.33 g/mol, XLogP of 0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-(4-methyl-1,4-dihydropyrimidin-6-yl)piperazine-1-carboxamide is sourced from PubChem (CID 118973362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).