About N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide
N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide (PubChem CID 118973734) has the molecular formula C14H21Cl2N5O
and a molecular weight of 346.26 g/mol. Its IUPAC name is N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide |
| PubChem CID | 118973734 |
| Molecular Formula | C14H21Cl2N5O |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)NCCCNc2nc(Cl)ncc2Cl)CC1 |
| InChI | InChI=1S/C14H21Cl2N5O/c1-21-7-3-10(4-8-21)13(22)18-6-2-5-17-12-11(15)9-19-14(16)20-12/h9-10H,2-8H2,1H3,(H,18,22)(H,17,19,20) |
| InChIKey | OTTRUINMSLVBQL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide?
The IUPAC name of N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide (CID 118973734) is N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide.
What is the SMILES notation for N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide?
The canonical SMILES for N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide is CN1CCC(C(=O)NCCCNc2nc(Cl)ncc2Cl)CC1.
What is the InChIKey of N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide?
The InChIKey is OTTRUINMSLVBQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21Cl2N5O/c1-21-7-3-10(4-8-21)13(22)18-6-2-5-17-12-11(15)9-19-14(16)20-12/h9-10H,2-8H2,1H3,(H,18,22)(H,17,19,20).
What are the key properties of N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide?
N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide has a molecular weight of 346.26 g/mol, XLogP of 2.04, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(2,5-dichloropyrimidin-4-yl)amino]propyl]-1-methylpiperidine-4-carboxamide is sourced from PubChem (CID 118973734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).