C22H24FNO4 — CID 118973987
(2R,4R,6R)-6-[4-fluoro-3-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)phenyl]-4-hydroxy-2-(hydroxymethyl)oxan-3-one (PubChem CID 118973987) has the molecular formula C22H24FNO4 and a molecular weight of 385.44 g/mol. Its IUPAC name is (2R,4R,6R)-6-[4-fluoro-3-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)phenyl]-4-hydroxy-2-(hydroxymethyl)oxan-3-one.
| Compound Name | (2R,4R,6R)-6-[4-fluoro-3-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)phenyl]-4-hydroxy-2-(hydroxymethyl)oxan-3-one |
|---|---|
| PubChem CID | 118973987 |
| Molecular Formula | C22H24FNO4 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (2R,4R,6R)-6-[4-fluoro-3-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)phenyl]-4-hydroxy-2-(hydroxymethyl)oxan-3-one |
| SMILES | O=C1[C@H](O)C[C@H](c2ccc(F)c(Cc3ccc4c(c3)CCCN4)c2)O[C@@H]1CO |
| InChI | InChI=1S/C22H24FNO4/c23-17-5-4-15(20-11-19(26)22(27)21(12-25)28-20)10-16(17)9-13-3-6-18-14(8-13)2-1-7-24-18/h3-6,8,10,19-21,24-26H,1-2,7,9,11-12H2/t19-,20-,21-/m1/s1 |
| InChIKey | FBBVMZWCZCKYCF-NJDAHSKKSA-N |
| XLogP | 2.53 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |