C7H16NO+ — CID 11897414
(2S,3S,4S)-2,3-dimethylpiperidin-1-ium-4-ol (PubChem CID 11897414) has the molecular formula C7H16NO+ and a molecular weight of 130.21 g/mol. Its IUPAC name is (2S,3S,4S)-2,3-dimethylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3S,4S)-2,3-dimethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 11897414 |
| Molecular Formula | C7H16NO+ |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | (2S,3S,4S)-2,3-dimethylpiperidin-1-ium-4-ol |
| SMILES | C[C@H]1[C@H](C)[NH2+]CC[C@@H]1O |
| InChI | InChI=1S/C7H15NO/c1-5-6(2)8-4-3-7(5)9/h5-9H,3-4H2,1-2H3/p+1/t5-,6-,7-/m0/s1 |
| InChIKey | RSBKVKZYGJSCDI-ACZMJKKPSA-O |
| XLogP | -0.66 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |