About 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole
5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole (PubChem CID 118974270) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole.
Molecular Properties
| Compound Name | 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole |
| PubChem CID | 118974270 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole |
| SMILES | CN1Cc2cn(C3CCOCC3)nc2C1 |
| InChI | InChI=1S/C11H17N3O/c1-13-6-9-7-14(12-11(9)8-13)10-2-4-15-5-3-10/h7,10H,2-6,8H2,1H3 |
| InChIKey | RJMCUADCJVYFGI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole?
The IUPAC name of 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole (CID 118974270) is 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole.
What is the SMILES notation for 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole?
The canonical SMILES for 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole is CN1Cc2cn(C3CCOCC3)nc2C1.
What is the InChIKey of 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole?
The InChIKey is RJMCUADCJVYFGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O/c1-13-6-9-7-14(12-11(9)8-13)10-2-4-15-5-3-10/h7,10H,2-6,8H2,1H3.
What are the key properties of 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole?
5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole has a molecular weight of 207.28 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(oxan-4-yl)-4,6-dihydropyrrolo[3,4-c]pyrazole is sourced from PubChem (CID 118974270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).