C21H22F4N6O — CID 118974428
(9S)-N-(5-fluoro-3-pyridinyl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118974428) has the molecular formula C21H22F4N6O and a molecular weight of 450.44 g/mol. Its IUPAC name is (9S)-N-(5-fluoro-3-pyridinyl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(5-fluoro-3-pyridinyl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118974428 |
| Molecular Formula | C21H22F4N6O |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (9S)-N-(5-fluoro-3-pyridinyl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cncc(F)c1)N1c2nc(N3CCCC(C(F)(F)F)C3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C21H22F4N6O/c22-14-8-15(10-26-9-14)27-20(32)31-16-5-7-29(12-16)17-3-4-18(28-19(17)31)30-6-1-2-13(11-30)21(23,24)25/h3-4,8-10,13,16H,1-2,5-7,11-12H2,(H,27,32)/t13?,16-/m0/s1 |
| InChIKey | VWAJNUVGXHAFGW-VYIIXAMBSA-N |
| XLogP | 4.03 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |