About methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate
methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate (PubChem CID 118974431) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate |
| PubChem CID | 118974431 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate |
| SMILES | COC(=O)N1CCC12CN(C)C2 |
| InChI | InChI=1S/C8H14N2O2/c1-9-5-8(6-9)3-4-10(8)7(11)12-2/h3-6H2,1-2H3 |
| InChIKey | YSUXNZDOAKAWHY-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate?
The IUPAC name of methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate (CID 118974431) is methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate.
What is the SMILES notation for methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate?
The canonical SMILES for methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate is COC(=O)N1CCC12CN(C)C2.
What is the InChIKey of methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate?
The InChIKey is YSUXNZDOAKAWHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-9-5-8(6-9)3-4-10(8)7(11)12-2/h3-6H2,1-2H3.
What are the key properties of methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate?
methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate has a molecular weight of 170.21 g/mol, XLogP of 0.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-1,6-diazaspiro[3.3]heptane-1-carboxylate is sourced from PubChem (CID 118974431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).