C27H21F3N6O — CID 118974495
(9S)-N-(6-pyridin-3-yl-2-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118974495) has the molecular formula C27H21F3N6O and a molecular weight of 502.50 g/mol. Its IUPAC name is (9S)-N-(6-pyridin-3-yl-2-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(6-pyridin-3-yl-2-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118974495 |
| Molecular Formula | C27H21F3N6O |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | (9S)-N-(6-pyridin-3-yl-2-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cccc(-c2cccnc2)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C27H21F3N6O/c28-27(29,30)19-6-1-4-17(14-19)22-9-10-23-25(33-22)36(20-11-13-35(23)16-20)26(37)34-24-8-2-7-21(32-24)18-5-3-12-31-15-18/h1-10,12,14-15,20H,11,13,16H2,(H,32,34,37)/t20-/m0/s1 |
| InChIKey | YEUCYJQUVMVBFC-FQEVSTJZSA-N |
| XLogP | 5.86 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |