C9H16F2N2 — CID 118974515
5-(2,2-difluoroethyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 118974515) has the molecular formula C9H16F2N2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(2,2-difluoroethyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 118974515 |
| Molecular Formula | C9H16F2N2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 5-(2,2-difluoroethyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CN1CC2CN(CC(F)F)CC2C1 |
| InChI | InChI=1S/C9H16F2N2/c1-12-2-7-4-13(6-9(10)11)5-8(7)3-12/h7-9H,2-6H2,1H3 |
| InChIKey | DLKBIISSLWSOSI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |