C20H23F3N6OS — CID 118974546
(9S)-N-(4-methyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118974546) has the molecular formula C20H23F3N6OS and a molecular weight of 452.51 g/mol. Its IUPAC name is (9S)-N-(4-methyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(4-methyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118974546 |
| Molecular Formula | C20H23F3N6OS |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (9S)-N-(4-methyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1csc(NC(=O)N2c3nc(N4CCCC(C(F)(F)F)C4)ccc3N3CC[C@H]2C3)n1 |
| InChI | InChI=1S/C20H23F3N6OS/c1-12-11-31-18(24-12)26-19(30)29-14-6-8-27(10-14)15-4-5-16(25-17(15)29)28-7-2-3-13(9-28)20(21,22)23/h4-5,11,13-14H,2-3,6-10H2,1H3,(H,24,26,30)/t13?,14-/m0/s1 |
| InChIKey | AHJPNWVQOVIRSO-KZUDCZAMSA-N |
| XLogP | 4.26 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |