C22H27F3N8O — CID 118974550
(9S)-N-[4-(dimethylamino)pyrimidin-2-yl]-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118974550) has the molecular formula C22H27F3N8O and a molecular weight of 476.51 g/mol. Its IUPAC name is (9S)-N-[4-(dimethylamino)pyrimidin-2-yl]-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-(dimethylamino)pyrimidin-2-yl]-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118974550 |
| Molecular Formula | C22H27F3N8O |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (9S)-N-[4-(dimethylamino)pyrimidin-2-yl]-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CN(C)c1ccnc(NC(=O)N2c3nc(N4CCCC(C(F)(F)F)C4)ccc3N3CC[C@H]2C3)n1 |
| InChI | InChI=1S/C22H27F3N8O/c1-30(2)17-7-9-26-20(28-17)29-21(34)33-15-8-11-31(13-15)16-5-6-18(27-19(16)33)32-10-3-4-14(12-32)22(23,24)25/h5-7,9,14-15H,3-4,8,10-13H2,1-2H3,(H,26,28,29,34)/t14?,15-/m0/s1 |
| InChIKey | CVFHHVPCMNXUJL-LOACHALJSA-N |
| XLogP | 3.35 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |