C15H14F3IN2O2S — CID 118974602
(4-iodopiperidin-1-yl)-[5-[4-methyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophen-2-yl]methanone (PubChem CID 118974602) has the molecular formula C15H14F3IN2O2S and a molecular weight of 470.25 g/mol. Its IUPAC name is (4-iodopiperidin-1-yl)-[5-[4-methyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophen-2-yl]methanone.
| Compound Name | (4-iodopiperidin-1-yl)-[5-[4-methyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 118974602 |
| Molecular Formula | C15H14F3IN2O2S |
| Molecular Weight | 470.25 g/mol |
| Exact Mass | 469.98 |
| IUPAC Name | (4-iodopiperidin-1-yl)-[5-[4-methyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophen-2-yl]methanone |
| SMILES | Cc1c(-c2ccc(C(=O)N3CCC(I)CC3)s2)noc1C(F)(F)F |
| InChI | InChI=1S/C15H14F3IN2O2S/c1-8-12(20-23-13(8)15(16,17)18)10-2-3-11(24-10)14(22)21-6-4-9(19)5-7-21/h2-3,9H,4-7H2,1H3 |
| InChIKey | GKVSUUNRRRNPAC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|