About 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole
1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole (PubChem CID 118974737) has the molecular formula C11H11ClN2OS
and a molecular weight of 254.74 g/mol. Its IUPAC name is 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole.
Molecular Properties
| Compound Name | 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole |
| PubChem CID | 118974737 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole |
| SMILES | Cc1ncc(C2OCCc3ccsc32)n1Cl |
| InChI | InChI=1S/C11H11ClN2OS/c1-7-13-6-9(14(7)12)10-11-8(2-4-15-10)3-5-16-11/h3,5-6,10H,2,4H2,1H3 |
| InChIKey | JGXDUKZWHBYERV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole?
The IUPAC name of 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole (CID 118974737) is 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole.
What is the SMILES notation for 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole?
The canonical SMILES for 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole is Cc1ncc(C2OCCc3ccsc32)n1Cl.
What is the InChIKey of 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole?
The InChIKey is JGXDUKZWHBYERV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2OS/c1-7-13-6-9(14(7)12)10-11-8(2-4-15-10)3-5-16-11/h3,5-6,10H,2,4H2,1H3.
What are the key properties of 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole?
1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole has a molecular weight of 254.74 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-5-(5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl)-2-methylimidazole is sourced from PubChem (CID 118974737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).