C23H30N3O3S+ — CID 11897491
(1S,3S,3aR,6aR)-5-butyl-1-(2-methylsulfanylethyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione (PubChem CID 11897491) has the molecular formula C23H30N3O3S+ and a molecular weight of 428.58 g/mol. Its IUPAC name is (1S,3S,3aR,6aR)-5-butyl-1-(2-methylsulfanylethyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione.
| Compound Name | (1S,3S,3aR,6aR)-5-butyl-1-(2-methylsulfanylethyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 11897491 |
| Molecular Formula | C23H30N3O3S+ |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (1S,3S,3aR,6aR)-5-butyl-1-(2-methylsulfanylethyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione |
| SMILES | C=CCN1C(=O)[C@@]2([NH2+][C@@H](CCSC)[C@@H]3C(=O)N(CCCC)C(=O)[C@H]32)c2ccccc21 |
| InChI | InChI=1S/C23H29N3O3S/c1-4-6-13-26-20(27)18-16(11-14-30-3)24-23(19(18)21(26)28)15-9-7-8-10-17(15)25(12-5-2)22(23)29/h5,7-10,16,18-19,24H,2,4,6,11-14H2,1,3H3/p+1/t16-,18-,19-,23+/m0/s1 |
| InChIKey | NCNIDYUNYSXZSI-YRAONVGVSA-O |
| XLogP | 1.51 |
| TPSA | 74.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|