C19H20FN5O — CID 118975170
3-fluoro-14-oxa-7,11,18,19,22-pentazapentacyclo[13.5.2.28,11.12,6.018,21]pentacosa-1(21),2,4,6(25),15(22),16,19-heptaene (PubChem CID 118975170) has the molecular formula C19H20FN5O and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-fluoro-14-oxa-7,11,18,19,22-pentazapentacyclo[13.5.2.28,11.12,6.018,21]pentacosa-1(21),2,4,6(25),15(22),16,19-heptaene.
| Compound Name | 3-fluoro-14-oxa-7,11,18,19,22-pentazapentacyclo[13.5.2.28,11.12,6.018,21]pentacosa-1(21),2,4,6(25),15(22),16,19-heptaene |
|---|---|
| PubChem CID | 118975170 |
| Molecular Formula | C19H20FN5O |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-fluoro-14-oxa-7,11,18,19,22-pentazapentacyclo[13.5.2.28,11.12,6.018,21]pentacosa-1(21),2,4,6(25),15(22),16,19-heptaene |
| SMILES | Fc1ccc2cc1-c1cnn3ccc(nc13)OCCN1CCC(CC1)N2 |
| InChI | InChI=1S/C19H20FN5O/c20-17-2-1-14-11-15(17)16-12-21-25-8-5-18(23-19(16)25)26-10-9-24-6-3-13(22-14)4-7-24/h1-2,5,8,11-13,22H,3-4,6-7,9-10H2 |
| InChIKey | RYRDEHUYNYQVOQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |