About 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine
7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine (PubChem CID 118975938) has the molecular formula C15H15FN6
and a molecular weight of 298.32 g/mol. Its IUPAC name is 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine |
| PubChem CID | 118975938 |
| Molecular Formula | C15H15FN6 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine |
| SMILES | FC1CCN(c2ccn3cc(-c4cnccn4)nc3n2)CC1 |
| InChI | InChI=1S/C15H15FN6/c16-11-1-6-21(7-2-11)14-3-8-22-10-13(19-15(22)20-14)12-9-17-4-5-18-12/h3-5,8-11H,1-2,6-7H2 |
| InChIKey | OXKUMSJGDYGWID-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine?
The IUPAC name of 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine (CID 118975938) is 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine.
What is the SMILES notation for 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine?
The canonical SMILES for 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine is FC1CCN(c2ccn3cc(-c4cnccn4)nc3n2)CC1.
What is the InChIKey of 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine?
The InChIKey is OXKUMSJGDYGWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FN6/c16-11-1-6-21(7-2-11)14-3-8-22-10-13(19-15(22)20-14)12-9-17-4-5-18-12/h3-5,8-11H,1-2,6-7H2.
What are the key properties of 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine?
7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine has a molecular weight of 298.32 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-fluoropiperidin-1-yl)-2-pyrazin-2-ylimidazo[1,2-a]pyrimidine is sourced from PubChem (CID 118975938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).