C16H20Cl2N3O2+ — CID 11897614
2-[(2S,4aR,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-1-ium-2-yl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 11897614) has the molecular formula C16H20Cl2N3O2+ and a molecular weight of 357.26 g/mol. Its IUPAC name is 2-[(2S,4aR,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-1-ium-2-yl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[(2S,4aR,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-1-ium-2-yl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 11897614 |
| Molecular Formula | C16H20Cl2N3O2+ |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-[(2S,4aR,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-1-ium-2-yl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(C[C@@H]1[NH2+][C@H]2CCCC[C@H]2NC1=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2N3O2/c17-10-6-5-9(7-11(10)18)19-15(22)8-14-16(23)21-13-4-2-1-3-12(13)20-14/h5-7,12-14,20H,1-4,8H2,(H,19,22)(H,21,23)/p+1/t12-,13+,14-/m0/s1 |
| InChIKey | RBRJBWWMUKFSAA-MJBXVCDLSA-O |
| XLogP | 1.70 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |