C24H27F3N6O3 — CID 118977362
N-[1-[2-[4-amino-3-(trifluoromethyl)anilino]-6,7-dimethoxyquinazolin-4-yl]piperidin-3-yl]acetamide (PubChem CID 118977362) has the molecular formula C24H27F3N6O3 and a molecular weight of 504.51 g/mol. Its IUPAC name is N-[1-[2-[4-amino-3-(trifluoromethyl)anilino]-6,7-dimethoxyquinazolin-4-yl]piperidin-3-yl]acetamide.
| Compound Name | N-[1-[2-[4-amino-3-(trifluoromethyl)anilino]-6,7-dimethoxyquinazolin-4-yl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 118977362 |
| Molecular Formula | C24H27F3N6O3 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | N-[1-[2-[4-amino-3-(trifluoromethyl)anilino]-6,7-dimethoxyquinazolin-4-yl]piperidin-3-yl]acetamide |
| SMILES | COc1cc2nc(Nc3ccc(N)c(C(F)(F)F)c3)nc(N3CCCC(NC(C)=O)C3)c2cc1OC |
| InChI | InChI=1S/C24H27F3N6O3/c1-13(34)29-15-5-4-8-33(12-15)22-16-10-20(35-2)21(36-3)11-19(16)31-23(32-22)30-14-6-7-18(28)17(9-14)24(25,26)27/h6-7,9-11,15H,4-5,8,12,28H2,1-3H3,(H,29,34)(H,30,31,32) |
| InChIKey | CNVQDSGCILXNQJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|