C28H30F3N5O3 — CID 118977697
3-cyano-N-[1,4-dimethyl-3-[(2S,4R)-2-methyl-1-[(2S)-3,3,3-trifluoro-2-methylpropanoyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-5-yl]-4-methoxybenzamide (PubChem CID 118977697) has the molecular formula C28H30F3N5O3 and a molecular weight of 541.57 g/mol. Its IUPAC name is 3-cyano-N-[1,4-dimethyl-3-[(2S,4R)-2-methyl-1-[(2S)-3,3,3-trifluoro-2-methylpropanoyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-5-yl]-4-methoxybenzamide.
| Compound Name | 3-cyano-N-[1,4-dimethyl-3-[(2S,4R)-2-methyl-1-[(2S)-3,3,3-trifluoro-2-methylpropanoyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-5-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 118977697 |
| Molecular Formula | C28H30F3N5O3 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 3-cyano-N-[1,4-dimethyl-3-[(2S,4R)-2-methyl-1-[(2S)-3,3,3-trifluoro-2-methylpropanoyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-5-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cnc3c(c([C@@H]4CCN(C(=O)[C@H](C)C(F)(F)F)[C@@H](C)C4)cn3C)c2C)cc1C#N |
| InChI | InChI=1S/C28H30F3N5O3/c1-15-10-18(8-9-36(15)27(38)17(3)28(29,30)31)21-14-35(4)25-24(21)16(2)22(13-33-25)34-26(37)19-6-7-23(39-5)20(11-19)12-32/h6-7,11,13-15,17-18H,8-10H2,1-5H3,(H,34,37)/t15-,17-,18+/m0/s1 |
| InChIKey | FHECTQTXNDHRBR-RYQLBKOJSA-N |
| XLogP | 5.31 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |