C35H34ClF2N3O8 — CID 118977887
1-cyclohexyloxycarbonyloxyethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[[3-(2-fluorophenyl)-1,2-oxazole-5-carbonyl]amino]amino]-2-hydroxypropanoate (PubChem CID 118977887) has the molecular formula C35H34ClF2N3O8 and a molecular weight of 698.12 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyloxyethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[[3-(2-fluorophenyl)-1,2-oxazole-5-carbonyl]amino]amino]-2-hydroxypropanoate.
| Compound Name | 1-cyclohexyloxycarbonyloxyethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[[3-(2-fluorophenyl)-1,2-oxazole-5-carbonyl]amino]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 118977887 |
| Molecular Formula | C35H34ClF2N3O8 |
| Molecular Weight | 698.12 g/mol |
| Exact Mass | 697.20 |
| IUPAC Name | 1-cyclohexyloxycarbonyloxyethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[[3-(2-fluorophenyl)-1,2-oxazole-5-carbonyl]amino]amino]-2-hydroxypropanoate |
| SMILES | CC(OC(=O)OC1CCCCC1)OC(=O)C(O)CN(Cc1ccc(-c2cc(Cl)ccc2F)cc1)NC(=O)c1cc(-c2ccccc2F)no1 |
| InChI | InChI=1S/C35H34ClF2N3O8/c1-21(47-35(45)48-25-7-3-2-4-8-25)46-34(44)31(42)20-41(19-22-11-13-23(14-12-22)27-17-24(36)15-16-29(27)38)39-33(43)32-18-30(40-49-32)26-9-5-6-10-28(26)37/h5-6,9-18,21,25,31,42H,2-4,7-8,19-20H2,1H3,(H,39,43) |
| InChIKey | VSVXSEVCOXJVKY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.12 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|