About 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate
2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate (PubChem CID 118978089) has the molecular formula C12H11ClFN3O2S
and a molecular weight of 315.76 g/mol. Its IUPAC name is 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate.
Molecular Properties
| Compound Name | 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate |
| PubChem CID | 118978089 |
| Molecular Formula | C12H11ClFN3O2S |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate |
| SMILES | Cc1nc(-c2cncc(F)c2)sc1NC(=O)OCCCl |
| InChI | InChI=1S/C12H11ClFN3O2S/c1-7-10(17-12(18)19-3-2-13)20-11(16-7)8-4-9(14)6-15-5-8/h4-6H,2-3H2,1H3,(H,17,18) |
| InChIKey | JQNBPAMPZCNLJQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate?
The IUPAC name of 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate (CID 118978089) is 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate.
What is the SMILES notation for 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate?
The canonical SMILES for 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate is Cc1nc(-c2cncc(F)c2)sc1NC(=O)OCCCl.
What is the InChIKey of 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate?
The InChIKey is JQNBPAMPZCNLJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClFN3O2S/c1-7-10(17-12(18)19-3-2-13)20-11(16-7)8-4-9(14)6-15-5-8/h4-6H,2-3H2,1H3,(H,17,18).
What are the key properties of 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate?
2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate has a molecular weight of 315.76 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]carbamate is sourced from PubChem (CID 118978089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).