C30H48O2 — CID 118978202
(Z)-2-methyl-5-[(1R,2S,4S)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]pent-2-en-1-ol (PubChem CID 118978202) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is (Z)-2-methyl-5-[(1R,2S,4S)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]pent-2-en-1-ol.
| Compound Name | (Z)-2-methyl-5-[(1R,2S,4S)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]pent-2-en-1-ol |
|---|---|
| PubChem CID | 118978202 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | (Z)-2-methyl-5-[(1R,2S,4S)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]pent-2-en-1-ol |
| SMILES | C=C1[C@H]2CC[C@H](C2)[C@]1(C)CC/C=C(/C)CO.C=C1[C@H]2CC[C@H](C2)[C@]1(C)CC/C=C(/C)CO |
| InChI | InChI=1S/2C15H24O/c2*1-11(10-16)5-4-8-15(3)12(2)13-6-7-14(15)9-13/h2*5,13-14,16H,2,4,6-10H2,1,3H3/b2*11-5-/t2*13-,14+,15+/m00/s1 |
| InChIKey | LBZFQNPBZPDXCY-IPHHNRSZSA-N |
| XLogP | 7.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|