C31H32FN11O3 — CID 118978865
2-[(3R,4S)-3-fluoro-1-(1H-1,2,4-triazole-5-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118978865) has the molecular formula C31H32FN11O3 and a molecular weight of 625.67 g/mol. Its IUPAC name is 2-[(3R,4S)-3-fluoro-1-(1H-1,2,4-triazole-5-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-3-fluoro-1-(1H-1,2,4-triazole-5-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118978865 |
| Molecular Formula | C31H32FN11O3 |
| Molecular Weight | 625.67 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | 2-[(3R,4S)-3-fluoro-1-(1H-1,2,4-triazole-5-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1O[C@H]1CCN(C(=O)c2ncn[nH]2)C[C@H]1F |
| InChI | InChI=1S/C31H32FN11O3/c32-25-15-43(30(44)29-35-19-37-40-29)8-7-27(25)46-26-6-1-20(13-21(26)14-33)28-34-18-36-31(39-28)38-22-2-4-23(5-3-22)41-9-11-42(12-10-41)24-16-45-17-24/h1-6,13,18-19,24-25,27H,7-12,15-17H2,(H,35,37,40)(H,34,36,38,39)/t25-,27+/m1/s1 |
| InChIKey | KNQGQSHDLOCMSE-VPUSJEBWSA-N |
| XLogP | 2.42 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|