C32H37FN8O6 — CID 118978885
2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118978885) has the molecular formula C32H37FN8O6 and a molecular weight of 648.70 g/mol. Its IUPAC name is 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118978885 |
| Molecular Formula | C32H37FN8O6 |
| Molecular Weight | 648.70 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | COc1cc(Nc2ncnc(-c3ccc(O[C@H]4CCN(C(=O)[C@@H](O)CO)C[C@H]4F)c(C#N)c3)n2)ccc1N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C32H37FN8O6/c1-45-29-13-22(3-4-25(29)40-10-8-39(9-11-40)23-17-46-18-23)37-32-36-19-35-30(38-32)20-2-5-27(21(12-20)14-34)47-28-6-7-41(15-24(28)33)31(44)26(43)16-42/h2-5,12-13,19,23-24,26,28,42-43H,6-11,15-18H2,1H3,(H,35,36,37,38)/t24-,26+,28+/m1/s1 |
| InChIKey | LTWUQUYWPHRFIK-XDIPAPSNSA-N |
| XLogP | 1.35 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.70 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|