C30H32FN7O4 — CID 118979009
5-[4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)anilino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile (PubChem CID 118979009) has the molecular formula C30H32FN7O4 and a molecular weight of 573.63 g/mol. Its IUPAC name is 5-[4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)anilino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile.
| Compound Name | 5-[4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)anilino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 118979009 |
| Molecular Formula | C30H32FN7O4 |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 5-[4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)anilino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile |
| SMILES | C[C@H](O)C(=O)N1CC[C@H](Oc2ccc(-c3ncnc(Nc4ccc(N5CC6COCC6C5)cc4)n3)cc2C#N)[C@H](F)C1 |
| InChI | InChI=1S/C30H32FN7O4/c1-18(39)29(40)37-9-8-27(25(31)14-37)42-26-7-2-19(10-20(26)11-32)28-33-17-34-30(36-28)35-23-3-5-24(6-4-23)38-12-21-15-41-16-22(21)13-38/h2-7,10,17-18,21-22,25,27,39H,8-9,12-16H2,1H3,(H,33,34,35,36)/t18-,21?,22?,25+,27-/m0/s1 |
| InChIKey | GBXFHUPSCBGJQZ-ZWEPCEAQSA-N |
| XLogP | 2.94 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|