C32H37FN8O5 — CID 118979033
2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[3-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118979033) has the molecular formula C32H37FN8O5 and a molecular weight of 632.70 g/mol. Its IUPAC name is 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[3-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[3-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118979033 |
| Molecular Formula | C32H37FN8O5 |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[3-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | Cc1cc(Nc2ncnc(-c3ccc(O[C@H]4CCN(C(=O)[C@@H](O)CO)C[C@H]4F)c(C#N)c3)n2)ccc1N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C32H37FN8O5/c1-20-12-23(3-4-26(20)40-10-8-39(9-11-40)24-17-45-18-24)37-32-36-19-35-30(38-32)21-2-5-28(22(13-21)14-34)46-29-6-7-41(15-25(29)33)31(44)27(43)16-42/h2-5,12-13,19,24-25,27,29,42-43H,6-11,15-18H2,1H3,(H,35,36,37,38)/t25-,27+,29+/m1/s1 |
| InChIKey | ZUULQRGJBADZKY-WBJKNQCFSA-N |
| XLogP | 1.65 |
| TPSA | 160.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|