C26H28FN7O5S — CID 118979525
ethyl 5-[[4-[3-cyano-4-[(3R,4S)-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 118979525) has the molecular formula C26H28FN7O5S and a molecular weight of 569.62 g/mol. Its IUPAC name is ethyl 5-[[4-[3-cyano-4-[(3R,4S)-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-[[4-[3-cyano-4-[(3R,4S)-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 118979525 |
| Molecular Formula | C26H28FN7O5S |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | ethyl 5-[[4-[3-cyano-4-[(3R,4S)-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1Nc1ncnc(-c2ccc(O[C@H]3CCN(C(=O)OC(C)(C)C)C[C@H]3F)c(C#N)c2)n1 |
| InChI | InChI=1S/C26H28FN7O5S/c1-5-37-23(35)20-22(40-14-31-20)33-24-30-13-29-21(32-24)15-6-7-18(16(10-15)11-28)38-19-8-9-34(12-17(19)27)25(36)39-26(2,3)4/h6-7,10,13-14,17,19H,5,8-9,12H2,1-4H3,(H,29,30,32,33)/t17-,19+/m1/s1 |
| InChIKey | QZHQGSGFLXBEIJ-MJGOQNOKSA-N |
| XLogP | 4.51 |
| TPSA | 152.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |