C30H34FN9O5 — CID 118979598
2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[[6-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118979598) has the molecular formula C30H34FN9O5 and a molecular weight of 619.66 g/mol. Its IUPAC name is 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[[6-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[[6-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118979598 |
| Molecular Formula | C30H34FN9O5 |
| Molecular Weight | 619.66 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[[6-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)nc3)n2)ccc1O[C@H]1CCN(C(=O)[C@@H](O)CO)C[C@H]1F |
| InChI | InChI=1S/C30H34FN9O5/c31-23-14-40(29(43)24(42)15-41)6-5-26(23)45-25-3-1-19(11-20(25)12-32)28-34-18-35-30(37-28)36-21-2-4-27(33-13-21)39-9-7-38(8-10-39)22-16-44-17-22/h1-4,11,13,18,22-24,26,41-42H,5-10,14-17H2,(H,34,35,36,37)/t23-,24+,26+/m1/s1 |
| InChIKey | XCYPLUKAXOGVDS-USZFVNFHSA-N |
| XLogP | 0.74 |
| TPSA | 173.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.66 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |