C22H22FN7O3S — CID 118979819
2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-[4-[(2-methyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118979819) has the molecular formula C22H22FN7O3S and a molecular weight of 483.53 g/mol. Its IUPAC name is 2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-[4-[(2-methyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-[4-[(2-methyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118979819 |
| Molecular Formula | C22H22FN7O3S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-[4-[(2-methyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | Cc1ncc(Nc2ncnc(-c3ccc(O[C@H]4CCN(C(=O)[C@H](C)O)C[C@H]4F)c(C#N)c3)n2)s1 |
| InChI | InChI=1S/C22H22FN7O3S/c1-12(31)21(32)30-6-5-18(16(23)10-30)33-17-4-3-14(7-15(17)8-24)20-26-11-27-22(29-20)28-19-9-25-13(2)34-19/h3-4,7,9,11-12,16,18,31H,5-6,10H2,1-2H3,(H,26,27,28,29)/t12-,16+,18-/m0/s1 |
| InChIKey | XDWPKGIZJLZNOI-XZOAIXRZSA-N |
| XLogP | 2.62 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |