C31H36FN9O5 — CID 118980056
2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[[5-methyl-6-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118980056) has the molecular formula C31H36FN9O5 and a molecular weight of 633.69 g/mol. Its IUPAC name is 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[[5-methyl-6-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[[5-methyl-6-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118980056 |
| Molecular Formula | C31H36FN9O5 |
| Molecular Weight | 633.69 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | 2-[(3R,4S)-1-[(2S)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[[5-methyl-6-[4-(oxetan-3-yl)piperazin-1-yl]-3-pyridinyl]amino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | Cc1cc(Nc2ncnc(-c3ccc(OC4CCN(C(=O)[C@@H](O)CO)C[C@H]4F)c(C#N)c3)n2)cnc1N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C31H36FN9O5/c1-19-10-22(13-34-29(19)40-8-6-39(7-9-40)23-16-45-17-23)37-31-36-18-35-28(38-31)20-2-3-26(21(11-20)12-33)46-27-4-5-41(14-24(27)32)30(44)25(43)15-42/h2-3,10-11,13,18,23-25,27,42-43H,4-9,14-17H2,1H3,(H,35,36,37,38)/t24-,25+,27?/m1/s1 |
| InChIKey | SDJZXXAGAUAGTD-SDVJBAMBSA-N |
| XLogP | 1.05 |
| TPSA | 173.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.69 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |