C16H24N+ — CID 11898082
phenyl-[[(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium (PubChem CID 11898082) has the molecular formula C16H24N+ and a molecular weight of 230.38 g/mol. Its IUPAC name is phenyl-[[(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium.
| Compound Name | phenyl-[[(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 11898082 |
| Molecular Formula | C16H24N+ |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | phenyl-[[(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium |
| SMILES | CC1=C[C@@H](C)[C@H](C[NH2+]c2ccccc2)[C@@H](C)C1 |
| InChI | InChI=1S/C16H23N/c1-12-9-13(2)16(14(3)10-12)11-17-15-7-5-4-6-8-15/h4-9,13-14,16-17H,10-11H2,1-3H3/p+1/t13-,14+,16+/m1/s1 |
| InChIKey | SMWWVQKQXJKMRK-YCPHGPKFSA-O |
| XLogP | 3.12 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|