About 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid
1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid (PubChem CID 118981583) has the molecular formula C16H14F3NO3
and a molecular weight of 325.29 g/mol. Its IUPAC name is 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid |
| PubChem CID | 118981583 |
| Molecular Formula | C16H14F3NO3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid |
| SMILES | O=C(O)C1=CC2=C(COC2)N(Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C16H14F3NO3/c17-16(18,19)13-3-1-10(2-4-13)6-20-7-11(15(21)22)5-12-8-23-9-14(12)20/h1-5H,6-9H2,(H,21,22) |
| InChIKey | PIDWVUVWDZITLL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid?
The IUPAC name of 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid (CID 118981583) is 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid.
What is the SMILES notation for 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid?
The canonical SMILES for 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid is O=C(O)C1=CC2=C(COC2)N(Cc2ccc(C(F)(F)F)cc2)C1.
What is the InChIKey of 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid?
The InChIKey is PIDWVUVWDZITLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3NO3/c17-16(18,19)13-3-1-10(2-4-13)6-20-7-11(15(21)22)5-12-8-23-9-14(12)20/h1-5H,6-9H2,(H,21,22).
What are the key properties of 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid?
1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid has a molecular weight of 325.29 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydro-2H-furo[3,4-b]pyridine-3-carboxylic acid is sourced from PubChem (CID 118981583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).