C7H9NO — CID 118981662
1,2,5,7-tetrahydrofuro[3,4-b]pyridine (PubChem CID 118981662) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is 1,2,5,7-tetrahydrofuro[3,4-b]pyridine.
| Compound Name | 1,2,5,7-tetrahydrofuro[3,4-b]pyridine |
|---|---|
| PubChem CID | 118981662 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 1,2,5,7-tetrahydrofuro[3,4-b]pyridine |
| SMILES | C1=CC2=C(COC2)NC1 |
| InChI | InChI=1S/C7H9NO/c1-2-6-4-9-5-7(6)8-3-1/h1-2,8H,3-5H2 |
| InChIKey | GWYWCXHQKFLXAO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |