C21H23F2NO3 — CID 118981739
4-[2-[(3aR,6aS)-5-(3,4-difluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol (PubChem CID 118981739) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is 4-[2-[(3aR,6aS)-5-(3,4-difluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol.
| Compound Name | 4-[2-[(3aR,6aS)-5-(3,4-difluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol |
|---|---|
| PubChem CID | 118981739 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 4-[2-[(3aR,6aS)-5-(3,4-difluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol |
| SMILES | Oc1ccc(C(O)CN2C[C@H]3CC(Oc4ccc(F)c(F)c4)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C21H23F2NO3/c22-19-6-5-17(9-20(19)23)27-18-7-14-10-24(11-15(14)8-18)12-21(26)13-1-3-16(25)4-2-13/h1-6,9,14-15,18,21,25-26H,7-8,10-12H2/t14-,15+,18?,21? |
| InChIKey | RFMQELXSBUQROF-CHLRHJHGSA-N |
| XLogP | 3.49 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |