C16H19Cl3N2O2 — CID 118982392
4-amino-3,5,6-trichloropyridine-2-carboxylic acid;(1R,5R)-2,6,6-trimethylbicyclo[3.1.1]hept-2-ene (PubChem CID 118982392) has the molecular formula C16H19Cl3N2O2 and a molecular weight of 377.70 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloropyridine-2-carboxylic acid;(1R,5R)-2,6,6-trimethylbicyclo[3.1.1]hept-2-ene.
| Compound Name | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid;(1R,5R)-2,6,6-trimethylbicyclo[3.1.1]hept-2-ene |
|---|---|
| PubChem CID | 118982392 |
| Molecular Formula | C16H19Cl3N2O2 |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid;(1R,5R)-2,6,6-trimethylbicyclo[3.1.1]hept-2-ene |
| SMILES | CC1=CC[C@@H]2C[C@H]1C2(C)C.Nc1c(Cl)c(Cl)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C10H16.C6H3Cl3N2O2/c1-7-4-5-8-6-9(7)10(8,2)3;7-1-3(10)2(8)5(9)11-4(1)6(12)13/h4,8-9H,5-6H2,1-3H3;(H2,10,11)(H,12,13)/t8-,9-;/m1./s1 |
| InChIKey | LKXGTRICNDDECD-VTLYIQCISA-N |
| XLogP | 5.32 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|