C26H26N2O3 — CID 11898252
(1S,2S,6S,7S)-11-[(4-tert-butylphenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 11898252) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is (1S,2S,6S,7S)-11-[(4-tert-butylphenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | (1S,2S,6S,7S)-11-[(4-tert-butylphenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 11898252 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (1S,2S,6S,7S)-11-[(4-tert-butylphenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | CC(C)(C)c1ccc(CN2[C@@H]3C(=O)C=C[C@H]2[C@H]2C(=O)N(c4ccccc4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-26(2,3)17-11-9-16(10-12-17)15-27-19-13-14-20(29)23(27)22-21(19)24(30)28(25(22)31)18-7-5-4-6-8-18/h4-14,19,21-23H,15H2,1-3H3/t19-,21+,22-,23+/m0/s1 |
| InChIKey | BAOFZQRNJJVDHZ-FCJDFRRUSA-N |
| XLogP | 3.48 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|