C23H23ClNO2- — CID 11898269
(1S,2S,10S,11S,12R)-5-chloro-10-(2,5-dimethylphenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate (PubChem CID 11898269) has the molecular formula C23H23ClNO2- and a molecular weight of 380.90 g/mol. Its IUPAC name is (1S,2S,10S,11S,12R)-5-chloro-10-(2,5-dimethylphenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate.
| Compound Name | (1S,2S,10S,11S,12R)-5-chloro-10-(2,5-dimethylphenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate |
|---|---|
| PubChem CID | 11898269 |
| Molecular Formula | C23H23ClNO2- |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (1S,2S,10S,11S,12R)-5-chloro-10-(2,5-dimethylphenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate |
| SMILES | Cc1ccc(C)c([C@H]2Nc3c(C(=O)[O-])cc(Cl)cc3[C@H]3[C@H]4CC[C@H](C4)[C@@H]32)c1 |
| InChI | InChI=1S/C23H24ClNO2/c1-11-3-4-12(2)16(7-11)22-20-14-6-5-13(8-14)19(20)17-9-15(24)10-18(23(26)27)21(17)25-22/h3-4,7,9-10,13-14,19-20,22,25H,5-6,8H2,1-2H3,(H,26,27)/p-1/t13-,14+,19+,20-,22+/m0/s1 |
| InChIKey | HKGKAEGOUSTERL-IKEXIKCTSA-M |
| XLogP | 4.62 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |