C8H14N2S — CID 118982940
(3aS,4S,6aR)-4-ethyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole (PubChem CID 118982940) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-ethyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole.
| Compound Name | (3aS,4S,6aR)-4-ethyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 118982940 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (3aS,4S,6aR)-4-ethyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
| SMILES | C=C1N[C@H]2[C@H](CS[C@H]2CC)N1 |
| InChI | InChI=1S/C8H14N2S/c1-3-7-8-6(4-11-7)9-5(2)10-8/h6-10H,2-4H2,1H3/t6-,7-,8-/m0/s1 |
| InChIKey | OIMVGXKEQXYLEQ-FXQIFTODSA-N |
| XLogP | 0.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |