About [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate
[(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate (PubChem CID 118982949) has the molecular formula C6H10FNO2
and a molecular weight of 147.15 g/mol. Its IUPAC name is [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate |
| PubChem CID | 118982949 |
| Molecular Formula | C6H10FNO2 |
| Molecular Weight | 147.15 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC/C=C\F |
| InChI | InChI=1S/C6H10FNO2/c1-2-8-6(9)10-5-3-4-7/h3-4H,2,5H2,1H3,(H,8,9)/b4-3- |
| InChIKey | GAHOLOUUNIGIFC-ARJAWSKDSA-N |
| XLogP | 1.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.15 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate?
The IUPAC name of [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate (CID 118982949) is [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate.
What is the SMILES notation for [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate?
The canonical SMILES for [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate is CCNC(=O)OC/C=C\F.
What is the InChIKey of [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate?
The InChIKey is GAHOLOUUNIGIFC-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H10FNO2/c1-2-8-6(9)10-5-3-4-7/h3-4H,2,5H2,1H3,(H,8,9)/b4-3-.
What are the key properties of [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate?
[(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate has a molecular weight of 147.15 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-fluoroprop-2-enyl] N-ethylcarbamate is sourced from PubChem (CID 118982949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).