C54H56N2O2 — CID 118983087
ethenyl 4-[3,9-bis(4-butylphenyl)-5-phenylindolo[3,2-c]carbazol-12-yl]-2-ethyl-2-methylpentanoate (PubChem CID 118983087) has the molecular formula C54H56N2O2 and a molecular weight of 765.05 g/mol. Its IUPAC name is ethenyl 4-[3,9-bis(4-butylphenyl)-5-phenylindolo[3,2-c]carbazol-12-yl]-2-ethyl-2-methylpentanoate.
| Compound Name | ethenyl 4-[3,9-bis(4-butylphenyl)-5-phenylindolo[3,2-c]carbazol-12-yl]-2-ethyl-2-methylpentanoate |
|---|---|
| PubChem CID | 118983087 |
| Molecular Formula | C54H56N2O2 |
| Molecular Weight | 765.05 g/mol |
| Exact Mass | 764.43 |
| IUPAC Name | ethenyl 4-[3,9-bis(4-butylphenyl)-5-phenylindolo[3,2-c]carbazol-12-yl]-2-ethyl-2-methylpentanoate |
| SMILES | C=COC(=O)C(C)(CC)CC(C)n1c2ccc(-c3ccc(CCCC)cc3)cc2c2ccc3c(c4ccc(-c5ccc(CCCC)cc5)cc4n3-c3ccccc3)c21 |
| InChI | InChI=1S/C54H56N2O2/c1-7-11-16-38-20-24-40(25-21-38)42-29-32-48-47(34-42)45-31-33-49-51(52(45)55(48)37(5)36-54(6,9-3)53(57)58-10-4)46-30-28-43(41-26-22-39(23-27-41)17-12-8-2)35-50(46)56(49)44-18-14-13-15-19-44/h10,13-15,18-35,37H,4,7-9,11-12,16-17,36H2,1-3,5-6H3 |
| InChIKey | NTQVAOGBLBNQGF-UHFFFAOYSA-N |
| XLogP | 14.96 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.05 |
| LogP ≤ 5 | 14.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|