C28H30O9 — CID 118983376
(2S,3S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-(2,4,6-trimethoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 118983376) has the molecular formula C28H30O9 and a molecular weight of 510.54 g/mol. Its IUPAC name is (2S,3S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-(2,4,6-trimethoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S,3S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-(2,4,6-trimethoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 118983376 |
| Molecular Formula | C28H30O9 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | (2S,3S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-(2,4,6-trimethoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(OC)c2c(c1)O[C@H](c1ccc(OC)c(OC)c1)[C@H](c1c(OC)cc(OC)cc1OC)C2=O |
| InChI | InChI=1S/C28H30O9/c1-30-16-11-20(34-5)24(21(12-16)35-6)26-27(29)25-22(36-7)13-17(31-2)14-23(25)37-28(26)15-8-9-18(32-3)19(10-15)33-4/h8-14,26,28H,1-7H3/t26-,28-/m1/s1 |
| InChIKey | VZNAXNBZQSFKAO-IXCJQBJRSA-N |
| XLogP | 4.85 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |