About 3-diazenyl-1,3-diphenylbutan-1-ol
3-diazenyl-1,3-diphenylbutan-1-ol (PubChem CID 118983454) has the molecular formula C16H18N2O
and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-diazenyl-1,3-diphenylbutan-1-ol.
Molecular Properties
| Compound Name | 3-diazenyl-1,3-diphenylbutan-1-ol |
| PubChem CID | 118983454 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-diazenyl-1,3-diphenylbutan-1-ol |
| SMILES | [H]/N=N/C(C)(CC(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O/c1-16(18-17,14-10-6-3-7-11-14)12-15(19)13-8-4-2-5-9-13/h2-11,15,17,19H,12H2,1H3/b18-17+ |
| InChIKey | QMFGDOKAJQADMY-ISLYRVAYSA-N |
| XLogP | 4.06 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-diazenyl-1,3-diphenylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazenyl-1,3-diphenylbutan-1-ol?
The IUPAC name of 3-diazenyl-1,3-diphenylbutan-1-ol (CID 118983454) is 3-diazenyl-1,3-diphenylbutan-1-ol.
What is the SMILES notation for 3-diazenyl-1,3-diphenylbutan-1-ol?
The canonical SMILES for 3-diazenyl-1,3-diphenylbutan-1-ol is [H]/N=N/C(C)(CC(O)c1ccccc1)c1ccccc1.
What is the InChIKey of 3-diazenyl-1,3-diphenylbutan-1-ol?
The InChIKey is QMFGDOKAJQADMY-ISLYRVAYSA-N. The full InChI is InChI=1S/C16H18N2O/c1-16(18-17,14-10-6-3-7-11-14)12-15(19)13-8-4-2-5-9-13/h2-11,15,17,19H,12H2,1H3/b18-17+.
What are the key properties of 3-diazenyl-1,3-diphenylbutan-1-ol?
3-diazenyl-1,3-diphenylbutan-1-ol has a molecular weight of 254.33 g/mol, XLogP of 4.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazenyl-1,3-diphenylbutan-1-ol is sourced from PubChem (CID 118983454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).